C20H29N3O5 — CID 46037046
N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide (PubChem CID 46037046) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46037046 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide |
| SMILES | COCCCNC(=O)C(NC(=O)C1CC1)C1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H29N3O5/c1-27-12-3-9-21-19(25)17(22-18(24)15-5-6-15)14-7-10-23(11-8-14)20(26)16-4-2-13-28-16/h2,4,13-15,17H,3,5-12H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | OCRIWEBTHCISNJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|