C21H35N3O4 — CID 46037052
N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide (PubChem CID 46037052) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46037052 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]cyclopropanecarboxamide |
| SMILES | COCCCNC(=O)C(NC(=O)C1CC1)C1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C21H35N3O4/c1-28-14-4-11-22-20(26)18(23-19(25)16-7-8-16)15-9-12-24(13-10-15)21(27)17-5-2-3-6-17/h15-18H,2-14H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | IIFZZXOMNLSRGF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|