C22H31Cl2N3O2 — CID 46024308
N-butan-2-yl-2-cyclopentyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]acetamide (PubChem CID 46024308) has the molecular formula C22H31Cl2N3O2 and a molecular weight of 440.42 g/mol. Its IUPAC name is N-butan-2-yl-2-cyclopentyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-cyclopentyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46024308 |
| Molecular Formula | C22H31Cl2N3O2 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-butan-2-yl-2-cyclopentyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H31Cl2N3O2/c1-3-15(2)25-21(28)20(16-6-4-5-7-16)26-10-12-27(13-11-26)22(29)18-9-8-17(23)14-19(18)24/h8-9,14-16,20H,3-7,10-13H2,1-2H3,(H,25,28) |
| InChIKey | LXMAXJYZVXHGIU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |