C23H22FNO5S — CID 4602562
tert-butyl 2-[5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 4602562) has the molecular formula C23H22FNO5S and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl 2-[5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 4602562 |
| Molecular Formula | C23H22FNO5S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | tert-butyl 2-[5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)SC(=Cc2ccccc2OCc2ccccc2F)C1=O |
| InChI | InChI=1S/C23H22FNO5S/c1-23(2,3)30-20(26)13-25-21(27)19(31-22(25)28)12-15-8-5-7-11-18(15)29-14-16-9-4-6-10-17(16)24/h4-12H,13-14H2,1-3H3 |
| InChIKey | KYAGAJBKCAWZQX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|