C26H20FNO4S — CID 1317981
5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 1317981) has the molecular formula C26H20FNO4S and a molecular weight of 461.51 g/mol. Its IUPAC name is 5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1317981 |
| Molecular Formula | C26H20FNO4S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)CN2C(=O)SC(=Cc3ccccc3OCc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C26H20FNO4S/c1-17-10-12-18(13-11-17)22(29)15-28-25(30)24(33-26(28)31)14-19-6-3-5-9-23(19)32-16-20-7-2-4-8-21(20)27/h2-14H,15-16H2,1H3 |
| InChIKey | YXSNTTZNRJYIPM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|