C12H9Cl2N3S — CID 4602686
4-(2,6-dichlorophenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 4602686) has the molecular formula C12H9Cl2N3S and a molecular weight of 298.20 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-(2,6-dichlorophenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 4602686 |
| Molecular Formula | C12H9Cl2N3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | S=c1nc2c(c(-c3c(Cl)cccc3Cl)[nH]1)CCN2 |
| InChI | InChI=1S/C12H9Cl2N3S/c13-7-2-1-3-8(14)9(7)10-6-4-5-15-11(6)17-12(18)16-10/h1-3H,4-5H2,(H2,15,16,17,18) |
| InChIKey | PZNLODVUNUFBBE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|