C14H14FN3S — CID 3358925
4-(4-fluorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione (PubChem CID 3358925) has the molecular formula C14H14FN3S and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione.
| Compound Name | 4-(4-fluorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
|---|---|
| PubChem CID | 3358925 |
| Molecular Formula | C14H14FN3S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-(4-fluorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
| SMILES | Fc1ccc(-c2[nH]c(=S)nc3c2CCCCN3)cc1 |
| InChI | InChI=1S/C14H14FN3S/c15-10-6-4-9(5-7-10)12-11-3-1-2-8-16-13(11)18-14(19)17-12/h4-7H,1-3,8H2,(H2,16,17,18,19) |
| InChIKey | DDSZPWNGLLDCNJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|