C17H17N3 — CID 3481970
3-naphthalen-2-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine (PubChem CID 3481970) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-naphthalen-2-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine.
| Compound Name | 3-naphthalen-2-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 3481970 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-naphthalen-2-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
| SMILES | c1ccc2cc(-c3[nH]nc4c3CCCCN4)ccc2c1 |
| InChI | InChI=1S/C17H17N3/c1-2-6-13-11-14(9-8-12(13)5-1)16-15-7-3-4-10-18-17(15)20-19-16/h1-2,5-6,8-9,11H,3-4,7,10H2,(H2,18,19,20) |
| InChIKey | IWJSIYPNGVMRKX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |