About 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole
3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole (PubChem CID 59796953) has the molecular formula C15H10N2S
and a molecular weight of 250.33 g/mol. Its IUPAC name is 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole.
Molecular Properties
| Compound Name | 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole |
| PubChem CID | 59796953 |
| Molecular Formula | C15H10N2S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole |
| SMILES | c1ccc2cc(-c3[nH]nc4sccc34)ccc2c1 |
| InChI | InChI=1S/C15H10N2S/c1-2-4-11-9-12(6-5-10(11)3-1)14-13-7-8-18-15(13)17-16-14/h1-9H,(H,16,17) |
| InChIKey | JYNXBVOGSNELER-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole?
The IUPAC name of 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole (CID 59796953) is 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole.
What is the SMILES notation for 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole?
The canonical SMILES for 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole is c1ccc2cc(-c3[nH]nc4sccc34)ccc2c1.
What is the InChIKey of 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole?
The InChIKey is JYNXBVOGSNELER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2S/c1-2-4-11-9-12(6-5-10(11)3-1)14-13-7-8-18-15(13)17-16-14/h1-9H,(H,16,17).
What are the key properties of 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole?
3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole has a molecular weight of 250.33 g/mol, XLogP of 4.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-yl-2H-thieno[2,3-c]pyrazole is sourced from PubChem (CID 59796953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).