C15H12N2S — CID 71031828
3-naphthalen-2-yl-4,5-dihydro-2H-thieno[2,3-c]pyrazole (PubChem CID 71031828) has the molecular formula C15H12N2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-naphthalen-2-yl-4,5-dihydro-2H-thieno[2,3-c]pyrazole.
| Compound Name | 3-naphthalen-2-yl-4,5-dihydro-2H-thieno[2,3-c]pyrazole |
|---|---|
| PubChem CID | 71031828 |
| Molecular Formula | C15H12N2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-naphthalen-2-yl-4,5-dihydro-2H-thieno[2,3-c]pyrazole |
| SMILES | c1ccc2cc(-c3[nH]nc4c3CCS4)ccc2c1 |
| InChI | InChI=1S/C15H12N2S/c1-2-4-11-9-12(6-5-10(11)3-1)14-13-7-8-18-15(13)17-16-14/h1-6,9H,7-8H2,(H,16,17) |
| InChIKey | WXBIPBRHVHVWGO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |