C14H16FN3 — CID 4007670
3-[(2-fluorophenyl)methyl]-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine (PubChem CID 4007670) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine.
| Compound Name | 3-[(2-fluorophenyl)methyl]-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 4007670 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
| SMILES | Fc1ccccc1Cc1[nH]nc2c1CCCCN2 |
| InChI | InChI=1S/C14H16FN3/c15-12-7-2-1-5-10(12)9-13-11-6-3-4-8-16-14(11)18-17-13/h1-2,5,7H,3-4,6,8-9H2,(H2,16,17,18) |
| InChIKey | SQFIDGTXQBOYJR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |