C24H25N3O2S2 — CID 4602703
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4602703) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4602703 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(C)c(-n2c(SCc3c(C)noc3C)nc3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C24H25N3O2S2/c1-13-9-10-14(2)19(11-13)27-23(28)21-17-7-5-6-8-20(17)31-22(21)25-24(27)30-12-18-15(3)26-29-16(18)4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | MURRNAUWEVGWRT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |