C21H39N5O3 — CID 46027346
4-[1-cyclopentyl-2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 46027346) has the molecular formula C21H39N5O3 and a molecular weight of 409.58 g/mol. Its IUPAC name is 4-[1-cyclopentyl-2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[1-cyclopentyl-2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 46027346 |
| Molecular Formula | C21H39N5O3 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | 4-[1-cyclopentyl-2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(C(=O)NCCCN2CCOCC2)C2CCCC2)CC1 |
| InChI | InChI=1S/C21H39N5O3/c1-2-22-21(28)26-12-10-25(11-13-26)19(18-6-3-4-7-18)20(27)23-8-5-9-24-14-16-29-17-15-24/h18-19H,2-17H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | ZAMYXUGQBRFMKT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|