C25H36Cl2N4O3 — CID 46024760
2-cyclopentyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 46024760) has the molecular formula C25H36Cl2N4O3 and a molecular weight of 511.49 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-cyclopentyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 46024760 |
| Molecular Formula | C25H36Cl2N4O3 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-cyclopentyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(NCCCN1CCOCC1)C(C1CCCC1)N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C25H36Cl2N4O3/c26-21-7-6-20(18-22(21)27)25(33)31-12-10-30(11-13-31)23(19-4-1-2-5-19)24(32)28-8-3-9-29-14-16-34-17-15-29/h6-7,18-19,23H,1-5,8-17H2,(H,28,32) |
| InChIKey | LNEFNBJNDTYLMQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|