C18H32N4O2S — CID 93221518
4-[(1R)-1-cyclopentyl-2-oxo-2-thiomorpholin-4-ylethyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 93221518) has the molecular formula C18H32N4O2S and a molecular weight of 368.55 g/mol. Its IUPAC name is 4-[(1R)-1-cyclopentyl-2-oxo-2-thiomorpholin-4-ylethyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[(1R)-1-cyclopentyl-2-oxo-2-thiomorpholin-4-ylethyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 93221518 |
| Molecular Formula | C18H32N4O2S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-[(1R)-1-cyclopentyl-2-oxo-2-thiomorpholin-4-ylethyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN([C@@H](C(=O)N2CCSCC2)C2CCCC2)CC1 |
| InChI | InChI=1S/C18H32N4O2S/c1-2-19-18(24)22-9-7-20(8-10-22)16(15-5-3-4-6-15)17(23)21-11-13-25-14-12-21/h15-16H,2-14H2,1H3,(H,19,24)/t16-/m1/s1 |
| InChIKey | DQDILJJBZQAODQ-MRXNPFEDSA-N |
| XLogP | 1.47 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |