C27H39N3O4 — CID 46028045
1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 46028045) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is 1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 46028045 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 1-[[5-(2-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)CN(Cc1c(-c2ccccc2)noc1N1CCCCC1C)CC1CCCO1 |
| InChI | InChI=1S/C27H39N3O4/c1-3-15-32-20-23(31)17-29(18-24-13-9-16-33-24)19-25-26(22-11-5-4-6-12-22)28-34-27(25)30-14-8-7-10-21(30)2/h3-6,11-12,21,23-24,31H,1,7-10,13-20H2,2H3 |
| InChIKey | KADZKPBQMUMBNS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|