C23H35N3O4 — CID 46032274
N-[2-(2-methoxyethylamino)-1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxoethyl]-3-methylbutanamide (PubChem CID 46032274) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)-1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxoethyl]-3-methylbutanamide.
| Compound Name | N-[2-(2-methoxyethylamino)-1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 46032274 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[2-(2-methoxyethylamino)-1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxoethyl]-3-methylbutanamide |
| SMILES | COCCNC(=O)C(NC(=O)CC(C)C)C1CCN(C(=O)c2ccccc2C)CC1 |
| InChI | InChI=1S/C23H35N3O4/c1-16(2)15-20(27)25-21(22(28)24-11-14-30-4)18-9-12-26(13-10-18)23(29)19-8-6-5-7-17(19)3/h5-8,16,18,21H,9-15H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | HGJNEXIRRSCZGP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|