C23H23ClN2O2S — CID 46033752
1-[4-[6-tert-butyl-2-[(2-chlorophenyl)methylsulfanyl]pyrimidin-4-yl]oxyphenyl]ethanone (PubChem CID 46033752) has the molecular formula C23H23ClN2O2S and a molecular weight of 426.97 g/mol. Its IUPAC name is 1-[4-[6-tert-butyl-2-[(2-chlorophenyl)methylsulfanyl]pyrimidin-4-yl]oxyphenyl]ethanone.
| Compound Name | 1-[4-[6-tert-butyl-2-[(2-chlorophenyl)methylsulfanyl]pyrimidin-4-yl]oxyphenyl]ethanone |
|---|---|
| PubChem CID | 46033752 |
| Molecular Formula | C23H23ClN2O2S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-[4-[6-tert-butyl-2-[(2-chlorophenyl)methylsulfanyl]pyrimidin-4-yl]oxyphenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2cc(C(C)(C)C)nc(SCc3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C23H23ClN2O2S/c1-15(27)16-9-11-18(12-10-16)28-21-13-20(23(2,3)4)25-22(26-21)29-14-17-7-5-6-8-19(17)24/h5-13H,14H2,1-4H3 |
| InChIKey | RMZADCUBPVDCPG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |