C29H30N4O7 — CID 4603663
3-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1-(3-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 4603663) has the molecular formula C29H30N4O7 and a molecular weight of 546.58 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1-(3-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1-(3-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4603663 |
| Molecular Formula | C29H30N4O7 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1-(3-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N(C)CCc3ccc(OC)c(OC)c3)n(-c3cccc([N+](=O)[O-])c3)n2)c(OC)c1 |
| InChI | InChI=1S/C29H30N4O7/c1-31(14-13-19-9-12-26(38-3)28(15-19)40-5)29(34)25-18-24(23-11-10-22(37-2)17-27(23)39-4)30-32(25)20-7-6-8-21(16-20)33(35)36/h6-12,15-18H,13-14H2,1-5H3 |
| InChIKey | OKEPIHHHZBAMPD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 118.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|