C20H28N4O2S — CID 46056147
2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 46056147) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46056147 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(N2CCN(Cc3nc(C(=O)NCC(C)C)cs3)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O2S/c1-15(2)12-21-20(25)18-14-27-19(22-18)13-23-8-10-24(11-9-23)16-4-6-17(26-3)7-5-16/h4-7,14-15H,8-13H2,1-3H3,(H,21,25) |
| InChIKey | HKTBJJDMABRUHD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|