C21H19ClN4O3 — CID 46061745
7-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-methoxyphenyl)purine-2,6-dione (PubChem CID 46061745) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-methoxyphenyl)purine-2,6-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-methoxyphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 46061745 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-1-ethyl-3-(2-methoxyphenyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccccc2Cl)n(-c2ccccc2OC)c1=O |
| InChI | InChI=1S/C21H19ClN4O3/c1-3-25-20(27)18-19(23-13-24(18)12-14-8-4-5-9-15(14)22)26(21(25)28)16-10-6-7-11-17(16)29-2/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | MDKOJHIDPHHAJC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |