C24H23ClN4O3 — CID 46061753
7-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-(2-methoxyphenyl)purine-2,6-dione (PubChem CID 46061753) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-(2-methoxyphenyl)purine-2,6-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-(2-methoxyphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 46061753 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-(2-methoxyphenyl)purine-2,6-dione |
| SMILES | COc1ccccc1-n1c(=O)n(C2CCCC2)c(=O)c2c1ncn2Cc1ccccc1Cl |
| InChI | InChI=1S/C24H23ClN4O3/c1-32-20-13-7-6-12-19(20)29-22-21(23(30)28(24(29)31)17-9-3-4-10-17)27(15-26-22)14-16-8-2-5-11-18(16)25/h2,5-8,11-13,15,17H,3-4,9-10,14H2,1H3 |
| InChIKey | QINOVXSDGYMQLQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |