C22H20N4O3 — CID 42862789
7-benzyl-1-cyclopropyl-3-(2-methoxyphenyl)purine-2,6-dione (PubChem CID 42862789) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 7-benzyl-1-cyclopropyl-3-(2-methoxyphenyl)purine-2,6-dione.
| Compound Name | 7-benzyl-1-cyclopropyl-3-(2-methoxyphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 42862789 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 7-benzyl-1-cyclopropyl-3-(2-methoxyphenyl)purine-2,6-dione |
| SMILES | COc1ccccc1-n1c(=O)n(C2CC2)c(=O)c2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C22H20N4O3/c1-29-18-10-6-5-9-17(18)26-20-19(21(27)25(22(26)28)16-11-12-16)24(14-23-20)13-15-7-3-2-4-8-15/h2-10,14,16H,11-13H2,1H3 |
| InChIKey | YKQRGIBEVQVEBS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |