C19H22N4O3 — CID 42862793
1-cyclopentyl-7-ethyl-3-(2-methoxyphenyl)purine-2,6-dione (PubChem CID 42862793) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-cyclopentyl-7-ethyl-3-(2-methoxyphenyl)purine-2,6-dione.
| Compound Name | 1-cyclopentyl-7-ethyl-3-(2-methoxyphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 42862793 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-cyclopentyl-7-ethyl-3-(2-methoxyphenyl)purine-2,6-dione |
| SMILES | CCn1cnc2c1c(=O)n(C1CCCC1)c(=O)n2-c1ccccc1OC |
| InChI | InChI=1S/C19H22N4O3/c1-3-21-12-20-17-16(21)18(24)22(13-8-4-5-9-13)19(25)23(17)14-10-6-7-11-15(14)26-2/h6-7,10-13H,3-5,8-9H2,1-2H3 |
| InChIKey | FLKLOTLZYOVZCB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |