C25H26N4O3 — CID 42862764
1-cyclohexyl-7-[(4-methoxyphenyl)methyl]-3-phenylpurine-2,6-dione (PubChem CID 42862764) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-cyclohexyl-7-[(4-methoxyphenyl)methyl]-3-phenylpurine-2,6-dione.
| Compound Name | 1-cyclohexyl-7-[(4-methoxyphenyl)methyl]-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 42862764 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-cyclohexyl-7-[(4-methoxyphenyl)methyl]-3-phenylpurine-2,6-dione |
| SMILES | COc1ccc(Cn2cnc3c2c(=O)n(C2CCCCC2)c(=O)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-32-21-14-12-18(13-15-21)16-27-17-26-23-22(27)24(30)29(20-10-6-3-7-11-20)25(31)28(23)19-8-4-2-5-9-19/h2,4-5,8-9,12-15,17,20H,3,6-7,10-11,16H2,1H3 |
| InChIKey | FSEOPLNTKHVRDZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |