C25H23ClN4O4 — CID 42863116
methyl 4-[[3-(2-chlorophenyl)-1-cyclopentyl-2,6-dioxopurin-7-yl]methyl]benzoate (PubChem CID 42863116) has the molecular formula C25H23ClN4O4 and a molecular weight of 478.94 g/mol. Its IUPAC name is methyl 4-[[3-(2-chlorophenyl)-1-cyclopentyl-2,6-dioxopurin-7-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3-(2-chlorophenyl)-1-cyclopentyl-2,6-dioxopurin-7-yl]methyl]benzoate |
|---|---|
| PubChem CID | 42863116 |
| Molecular Formula | C25H23ClN4O4 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | methyl 4-[[3-(2-chlorophenyl)-1-cyclopentyl-2,6-dioxopurin-7-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2cnc3c2c(=O)n(C2CCCC2)c(=O)n3-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H23ClN4O4/c1-34-24(32)17-12-10-16(11-13-17)14-28-15-27-22-21(28)23(31)29(18-6-2-3-7-18)25(33)30(22)20-9-5-4-8-19(20)26/h4-5,8-13,15,18H,2-3,6-7,14H2,1H3 |
| InChIKey | VTKVINSXLGZFTB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |