C25H22ClN5O2 — CID 42863114
3-[[3-(2-chlorophenyl)-1-cyclohexyl-2,6-dioxopurin-7-yl]methyl]benzonitrile (PubChem CID 42863114) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is 3-[[3-(2-chlorophenyl)-1-cyclohexyl-2,6-dioxopurin-7-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-(2-chlorophenyl)-1-cyclohexyl-2,6-dioxopurin-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 42863114 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-[[3-(2-chlorophenyl)-1-cyclohexyl-2,6-dioxopurin-7-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2cnc3c2c(=O)n(C2CCCCC2)c(=O)n3-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H22ClN5O2/c26-20-11-4-5-12-21(20)31-23-22(24(32)30(25(31)33)19-9-2-1-3-10-19)29(16-28-23)15-18-8-6-7-17(13-18)14-27/h4-8,11-13,16,19H,1-3,9-10,15H2 |
| InChIKey | LJBIODDBULIRJP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |