C21H17FN4O2 — CID 46060833
1-cyclopropyl-7-[(2-fluorophenyl)methyl]-3-phenylpurine-2,6-dione (PubChem CID 46060833) has the molecular formula C21H17FN4O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is 1-cyclopropyl-7-[(2-fluorophenyl)methyl]-3-phenylpurine-2,6-dione.
| Compound Name | 1-cyclopropyl-7-[(2-fluorophenyl)methyl]-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 46060833 |
| Molecular Formula | C21H17FN4O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-cyclopropyl-7-[(2-fluorophenyl)methyl]-3-phenylpurine-2,6-dione |
| SMILES | O=c1c2c(ncn2Cc2ccccc2F)n(-c2ccccc2)c(=O)n1C1CC1 |
| InChI | InChI=1S/C21H17FN4O2/c22-17-9-5-4-6-14(17)12-24-13-23-19-18(24)20(27)26(16-10-11-16)21(28)25(19)15-7-2-1-3-8-15/h1-9,13,16H,10-12H2 |
| InChIKey | KOYCYLNVIMUPIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |