C26H33N3O2 — CID 46065202
1-[3-(4-benzylpiperazine-1-carbonyl)-5-(3-methylphenyl)piperidin-1-yl]ethanone (PubChem CID 46065202) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazine-1-carbonyl)-5-(3-methylphenyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[3-(4-benzylpiperazine-1-carbonyl)-5-(3-methylphenyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 46065202 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-[3-(4-benzylpiperazine-1-carbonyl)-5-(3-methylphenyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C(=O)N2CCN(Cc3ccccc3)CC2)CC(c2cccc(C)c2)C1 |
| InChI | InChI=1S/C26H33N3O2/c1-20-7-6-10-23(15-20)24-16-25(19-29(18-24)21(2)30)26(31)28-13-11-27(12-14-28)17-22-8-4-3-5-9-22/h3-10,15,24-25H,11-14,16-19H2,1-2H3 |
| InChIKey | WKERQUNGZIHBDA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |