C32H36N2O2 — CID 42868439
[1-benzoyl-5-(3-methylphenyl)piperidin-3-yl]-(4-benzylpiperidin-1-yl)methanone (PubChem CID 42868439) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is [1-benzoyl-5-(3-methylphenyl)piperidin-3-yl]-(4-benzylpiperidin-1-yl)methanone.
| Compound Name | [1-benzoyl-5-(3-methylphenyl)piperidin-3-yl]-(4-benzylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 42868439 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | [1-benzoyl-5-(3-methylphenyl)piperidin-3-yl]-(4-benzylpiperidin-1-yl)methanone |
| SMILES | Cc1cccc(C2CC(C(=O)N3CCC(Cc4ccccc4)CC3)CN(C(=O)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C32H36N2O2/c1-24-9-8-14-28(19-24)29-21-30(23-34(22-29)31(35)27-12-6-3-7-13-27)32(36)33-17-15-26(16-18-33)20-25-10-4-2-5-11-25/h2-14,19,26,29-30H,15-18,20-23H2,1H3 |
| InChIKey | SBCVOLGEEVAOLF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |