C25H30N2O3 — CID 46166988
1-[3-(3-methylphenyl)-5-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone (PubChem CID 46166988) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[3-(3-methylphenyl)-5-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-(3-methylphenyl)-5-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 46166988 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[3-(3-methylphenyl)-5-(morpholine-4-carbonyl)piperidin-1-yl]-2-phenylethanone |
| SMILES | Cc1cccc(C2CC(C(=O)N3CCOCC3)CN(C(=O)Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C25H30N2O3/c1-19-6-5-9-21(14-19)22-16-23(25(29)26-10-12-30-13-11-26)18-27(17-22)24(28)15-20-7-3-2-4-8-20/h2-9,14,22-23H,10-13,15-18H2,1H3 |
| InChIKey | GXAJECCLZPWWDT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |