C30H29N3O5 — CID 4606828
diethyl 2-methyl-5-oxo-7-phenyl-4-quinoxalin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 4606828) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is diethyl 2-methyl-5-oxo-7-phenyl-4-quinoxalin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl 2-methyl-5-oxo-7-phenyl-4-quinoxalin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 4606828 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | diethyl 2-methyl-5-oxo-7-phenyl-4-quinoxalin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)C(C(=O)OCC)C(c3ccccc3)C2)C1c1cnc2ccccc2n1 |
| InChI | InChI=1S/C30H29N3O5/c1-4-37-29(35)24-17(3)32-22-15-19(18-11-7-6-8-12-18)25(30(36)38-5-2)28(34)27(22)26(24)23-16-31-20-13-9-10-14-21(20)33-23/h6-14,16,19,25-26,32H,4-5,15H2,1-3H3 |
| InChIKey | OJOJGAAXHLLCTB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|