C29H32N2O5 — CID 51689618
diethyl (4R,6S,7R)-5-oxo-7-phenyl-2-propyl-4-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51689618) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is diethyl (4R,6S,7R)-5-oxo-7-phenyl-2-propyl-4-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6S,7R)-5-oxo-7-phenyl-2-propyl-4-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51689618 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | diethyl (4R,6S,7R)-5-oxo-7-phenyl-2-propyl-4-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@H](c2ccccn2)C2=C(C[C@@H](c3ccccc3)[C@H](C(=O)OCC)C2=O)N1 |
| InChI | InChI=1S/C29H32N2O5/c1-4-12-21-26(29(34)36-6-3)24(20-15-10-11-16-30-20)25-22(31-21)17-19(18-13-8-7-9-14-18)23(27(25)32)28(33)35-5-2/h7-11,13-16,19,23-24,31H,4-6,12,17H2,1-3H3/t19-,23-,24+/m0/s1 |
| InChIKey | XTKHMEZHGQMLSL-WDJPJFJCSA-N |
| XLogP | 4.58 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|