C27H30N2O5S — CID 6558510
diethyl (4S,6R,7R)-5-oxo-2-propyl-4-pyridin-2-yl-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 6558510) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is diethyl (4S,6R,7R)-5-oxo-2-propyl-4-pyridin-2-yl-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6R,7R)-5-oxo-2-propyl-4-pyridin-2-yl-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6558510 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | diethyl (4S,6R,7R)-5-oxo-2-propyl-4-pyridin-2-yl-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2ccccn2)C2=C(C[C@@H](c3cccs3)[C@@H](C(=O)OCC)C2=O)N1 |
| InChI | InChI=1S/C27H30N2O5S/c1-4-10-18-24(27(32)34-6-3)22(17-11-7-8-13-28-17)23-19(29-18)15-16(20-12-9-14-35-20)21(25(23)30)26(31)33-5-2/h7-9,11-14,16,21-22,29H,4-6,10,15H2,1-3H3/t16-,21+,22-/m0/s1 |
| InChIKey | KLZFHBOXQSQEFN-USCONSEESA-N |
| XLogP | 4.64 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|