C28H31NO5S — CID 51689621
diethyl (4S,6S,7S)-5-oxo-7-phenyl-2-propyl-4-thiophen-3-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51689621) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is diethyl (4S,6S,7S)-5-oxo-7-phenyl-2-propyl-4-thiophen-3-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7S)-5-oxo-7-phenyl-2-propyl-4-thiophen-3-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51689621 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | diethyl (4S,6S,7S)-5-oxo-7-phenyl-2-propyl-4-thiophen-3-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2ccsc2)C2=C(C[C@H](c3ccccc3)[C@H](C(=O)OCC)C2=O)N1 |
| InChI | InChI=1S/C28H31NO5S/c1-4-10-20-25(28(32)34-6-3)22(18-13-14-35-16-18)24-21(29-20)15-19(17-11-8-7-9-12-17)23(26(24)30)27(31)33-5-2/h7-9,11-14,16,19,22-23,29H,4-6,10,15H2,1-3H3/t19-,22+,23+/m1/s1 |
| InChIKey | ABIAONRBDLIDLI-OIBXWCBGSA-N |
| XLogP | 5.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|