C26H29NO5S2 — CID 51708515
diethyl (4S,6S,7S)-5-oxo-2-propyl-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51708515) has the molecular formula C26H29NO5S2 and a molecular weight of 499.65 g/mol. Its IUPAC name is diethyl (4S,6S,7S)-5-oxo-2-propyl-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7S)-5-oxo-2-propyl-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51708515 |
| Molecular Formula | C26H29NO5S2 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | diethyl (4S,6S,7S)-5-oxo-2-propyl-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2cccs2)C2=C(C[C@H](c3cccs3)[C@H](C(=O)OCC)C2=O)N1 |
| InChI | InChI=1S/C26H29NO5S2/c1-4-9-16-22(26(30)32-6-3)23(19-11-8-13-34-19)21-17(27-16)14-15(18-10-7-12-33-18)20(24(21)28)25(29)31-5-2/h7-8,10-13,15,20,23,27H,4-6,9,14H2,1-3H3/t15-,20+,23+/m1/s1 |
| InChIKey | RHMGQKDHCDYNTO-XLHILCRZSA-N |
| XLogP | 5.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|