C22H21NO5S2 — CID 6558526
dimethyl (4S,6R,7R)-2-methyl-5-oxo-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 6558526) has the molecular formula C22H21NO5S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is dimethyl (4S,6R,7R)-2-methyl-5-oxo-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R,7R)-2-methyl-5-oxo-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6558526 |
| Molecular Formula | C22H21NO5S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | dimethyl (4S,6R,7R)-2-methyl-5-oxo-4,7-dithiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@H](c3cccs3)C2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C22H21NO5S2/c1-11-16(21(25)27-2)19(15-7-5-9-30-15)18-13(23-11)10-12(14-6-4-8-29-14)17(20(18)24)22(26)28-3/h4-9,12,17,19,23H,10H2,1-3H3/t12-,17+,19+/m0/s1 |
| InChIKey | ZKURANFXYXMRLU-OEPMTFCVSA-N |
| XLogP | 3.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|