C25H25NO6S — CID 51708511
dimethyl (4S,6S,7R)-4-(3-methoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51708511) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is dimethyl (4S,6S,7R)-4-(3-methoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6S,7R)-4-(3-methoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51708511 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | dimethyl (4S,6S,7R)-4-(3-methoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OC)[C@H](c3cccs3)C2)[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C25H25NO6S/c1-13-19(24(28)31-3)20(14-7-5-8-15(11-14)30-2)22-17(26-13)12-16(18-9-6-10-33-18)21(23(22)27)25(29)32-4/h5-11,16,20-21,26H,12H2,1-4H3/t16-,20+,21-/m0/s1 |
| InChIKey | UHACTSFCGPUNLY-DQLDELGASA-N |
| XLogP | 3.69 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|