C27H27NO6 — CID 979069
dimethyl (4S,6R,7S)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 979069) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is dimethyl (4S,6R,7S)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R,7S)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 979069 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | dimethyl (4S,6R,7S)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@@H](c3ccc(OC)cc3)C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H27NO6/c1-15-21(26(30)33-3)22(17-8-6-5-7-9-17)24-20(28-15)14-19(23(25(24)29)27(31)34-4)16-10-12-18(32-2)13-11-16/h5-13,19,22-23,28H,14H2,1-4H3/t19-,22-,23-/m1/s1 |
| InChIKey | JKBLWFSUMNMWEU-UEVCKROQSA-N |
| XLogP | 3.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|