C27H26ClNO6 — CID 6547040
dimethyl (4S,6R,7R)-4-(4-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 6547040) has the molecular formula C27H26ClNO6 and a molecular weight of 495.96 g/mol. Its IUPAC name is dimethyl (4S,6R,7R)-4-(4-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R,7R)-4-(4-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6547040 |
| Molecular Formula | C27H26ClNO6 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | dimethyl (4S,6R,7R)-4-(4-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@H](c3ccc(OC)cc3)C2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26ClNO6/c1-14-21(26(31)34-3)22(16-5-9-17(28)10-6-16)24-20(29-14)13-19(23(25(24)30)27(32)35-4)15-7-11-18(33-2)12-8-15/h5-12,19,22-23,29H,13H2,1-4H3/t19-,22+,23+/m0/s1 |
| InChIKey | LLIBYVWJHVWPSG-WWPVKYPJSA-N |
| XLogP | 4.28 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|