C26H27NO6S — CID 98398836
dimethyl (4S,6R,7R)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 98398836) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is dimethyl (4S,6R,7R)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R,7R)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98398836 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | dimethyl (4S,6R,7R)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOc1ccccc1[C@@H]1C(C(=O)OC)=C(C)NC2=C1C(=O)[C@H](C(=O)OC)[C@H](c1cccs1)C2 |
| InChI | InChI=1S/C26H27NO6S/c1-5-33-18-10-7-6-9-15(18)21-20(25(29)31-3)14(2)27-17-13-16(19-11-8-12-34-19)22(26(30)32-4)24(28)23(17)21/h6-12,16,21-22,27H,5,13H2,1-4H3/t16-,21+,22+/m0/s1 |
| InChIKey | NWHQRVOUICCRFL-KNXBSLHKSA-N |
| XLogP | 4.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|