C25H30FNO5 — CID 51691277
diethyl (4S,6S,7S)-4-(2-fluorophenyl)-7-methyl-5-oxo-2-propyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51691277) has the molecular formula C25H30FNO5 and a molecular weight of 443.52 g/mol. Its IUPAC name is diethyl (4S,6S,7S)-4-(2-fluorophenyl)-7-methyl-5-oxo-2-propyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7S)-4-(2-fluorophenyl)-7-methyl-5-oxo-2-propyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51691277 |
| Molecular Formula | C25H30FNO5 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | diethyl (4S,6S,7S)-4-(2-fluorophenyl)-7-methyl-5-oxo-2-propyl-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2ccccc2F)C2=C(C[C@H](C)[C@H](C(=O)OCC)C2=O)N1 |
| InChI | InChI=1S/C25H30FNO5/c1-5-10-17-22(25(30)32-7-3)20(15-11-8-9-12-16(15)26)21-18(27-17)13-14(4)19(23(21)28)24(29)31-6-2/h8-9,11-12,14,19-20,27H,5-7,10,13H2,1-4H3/t14-,19-,20-/m0/s1 |
| InChIKey | XTCPQGMXPXEZJO-GKCIPKSASA-N |
| XLogP | 4.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|