C14H11F13N4O — CID 4607499
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]heptanamide (PubChem CID 4607499) has the molecular formula C14H11F13N4O and a molecular weight of 498.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]heptanamide |
|---|---|
| PubChem CID | 4607499 |
| Molecular Formula | C14H11F13N4O |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]heptanamide |
| SMILES | Cc1nn(C)c(C)c1C=NNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F13N4O/c1-5-7(6(2)31(3)30-5)4-28-29-8(32)9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h4H,1-3H3,(H,29,32) |
| InChIKey | XXVQQNOXIJIQAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|