C19H17ClN4O4 — CID 46077800
5-chloro-1'-(3-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one (PubChem CID 46077800) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is 5-chloro-1'-(3-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one.
| Compound Name | 5-chloro-1'-(3-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 46077800 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 5-chloro-1'-(3-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
| SMILES | O=C1NC2(CCN(C(=O)c3cccc([N+](=O)[O-])c3)CC2)Nc2cccc(Cl)c21 |
| InChI | InChI=1S/C19H17ClN4O4/c20-14-5-2-6-15-16(14)17(25)22-19(21-15)7-9-23(10-8-19)18(26)12-3-1-4-13(11-12)24(27)28/h1-6,11,21H,7-10H2,(H,22,25) |
| InChIKey | SRNCZESJKLJGEO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|