C23H30N4O2 — CID 46080003
2-tert-butyl-5-(3-methoxyphenyl)-N-pentylpyrazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 46080003) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-tert-butyl-5-(3-methoxyphenyl)-N-pentylpyrazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | 2-tert-butyl-5-(3-methoxyphenyl)-N-pentylpyrazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 46080003 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-tert-butyl-5-(3-methoxyphenyl)-N-pentylpyrazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2cccc(OC)c2)nc2cc(C(C)(C)C)nn12 |
| InChI | InChI=1S/C23H30N4O2/c1-6-7-8-12-24-22(28)19-14-18(16-10-9-11-17(13-16)29-5)25-21-15-20(23(2,3)4)26-27(19)21/h9-11,13-15H,6-8,12H2,1-5H3,(H,24,28) |
| InChIKey | DTJXBXUGUYDGAU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|