C25H33N5O3 — CID 46170481
2-tert-butyl-5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 46170481) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-tert-butyl-5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | 2-tert-butyl-5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 46170481 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 2-tert-butyl-5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCN3CCOCC3)n3nc(C(C)(C)C)cc3n2)cc1 |
| InChI | InChI=1S/C25H33N5O3/c1-25(2,3)22-17-23-27-20(18-6-8-19(32-4)9-7-18)16-21(30(23)28-22)24(31)26-10-5-11-29-12-14-33-15-13-29/h6-9,16-17H,5,10-15H2,1-4H3,(H,26,31) |
| InChIKey | PVIXQMASRLXNBS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|