C28H38ClN5O3 — CID 42882271
tert-butyl N-[6-[[2-tert-butyl-5-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidine-7-carbonyl]amino]hexyl]carbamate (PubChem CID 42882271) has the molecular formula C28H38ClN5O3 and a molecular weight of 528.10 g/mol. Its IUPAC name is tert-butyl N-[6-[[2-tert-butyl-5-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidine-7-carbonyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[2-tert-butyl-5-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidine-7-carbonyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 42882271 |
| Molecular Formula | C28H38ClN5O3 |
| Molecular Weight | 528.10 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | tert-butyl N-[6-[[2-tert-butyl-5-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidine-7-carbonyl]amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=O)c1cc(-c2ccc(Cl)cc2)nc2cc(C(C)(C)C)nn12 |
| InChI | InChI=1S/C28H38ClN5O3/c1-27(2,3)23-18-24-32-21(19-11-13-20(29)14-12-19)17-22(34(24)33-23)25(35)30-15-9-7-8-10-16-31-26(36)37-28(4,5)6/h11-14,17-18H,7-10,15-16H2,1-6H3,(H,30,35)(H,31,36) |
| InChIKey | PCRUPLOPAQPJIS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.10 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|