C22H31N3O — CID 46081793
N-[3-[2-[cyclopropylmethyl(propyl)amino]ethyl]-1H-indol-5-yl]cyclobutanecarboxamide (PubChem CID 46081793) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[3-[2-[cyclopropylmethyl(propyl)amino]ethyl]-1H-indol-5-yl]cyclobutanecarboxamide.
| Compound Name | N-[3-[2-[cyclopropylmethyl(propyl)amino]ethyl]-1H-indol-5-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 46081793 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | N-[3-[2-[cyclopropylmethyl(propyl)amino]ethyl]-1H-indol-5-yl]cyclobutanecarboxamide |
| SMILES | CCCN(CCc1c[nH]c2ccc(NC(=O)C3CCC3)cc12)CC1CC1 |
| InChI | InChI=1S/C22H31N3O/c1-2-11-25(15-16-6-7-16)12-10-18-14-23-21-9-8-19(13-20(18)21)24-22(26)17-4-3-5-17/h8-9,13-14,16-17,23H,2-7,10-12,15H2,1H3,(H,24,26) |
| InChIKey | YIKKWWIHHCLROF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |