About [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone
[4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone (PubChem CID 46082003) has the molecular formula C24H24N4O3
and a molecular weight of 416.48 g/mol. Its IUPAC name is [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone.
Molecular Properties
| Compound Name | [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone |
| PubChem CID | 46082003 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(c3nccc(-c4ccc5c(c4)OCO5)n3)CC2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c1-2-17-3-5-18(6-4-17)23(29)27-11-13-28(14-12-27)24-25-10-9-20(26-24)19-7-8-21-22(15-19)31-16-30-21/h3-10,15H,2,11-14,16H2,1H3 |
| InChIKey | XKRUJYKCPANHPB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone?
The IUPAC name of [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone (CID 46082003) is [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone.
What is the SMILES notation for [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone?
The canonical SMILES for [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone is CCc1ccc(C(=O)N2CCN(c3nccc(-c4ccc5c(c4)OCO5)n3)CC2)cc1.
What is the InChIKey of [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone?
The InChIKey is XKRUJYKCPANHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O3/c1-2-17-3-5-18(6-4-17)23(29)27-11-13-28(14-12-27)24-25-10-9-20(26-24)19-7-8-21-22(15-19)31-16-30-21/h3-10,15H,2,11-14,16H2,1H3.
What are the key properties of [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone?
[4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone has a molecular weight of 416.48 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]piperazin-1-yl]-(4-ethylphenyl)methanone is sourced from PubChem (CID 46082003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).