C16H12F2N2OS — CID 4608475
N-(2,4-difluorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide (PubChem CID 4608475) has the molecular formula C16H12F2N2OS and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 4608475 |
| Molecular Formula | C16H12F2N2OS |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1c[nH]c2ccccc12)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H12F2N2OS/c17-10-5-6-14(12(18)7-10)20-16(21)9-22-15-8-19-13-4-2-1-3-11(13)15/h1-8,19H,9H2,(H,20,21) |
| InChIKey | VZGWKYURYATOCU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |